cas: 207857-35-0 — see every product listed under this CAS number, including other names
Fmoc-Arg(Z)2-OH, 95%, 95% (CAS 207857-35-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JBT-100mg |
| cas | 207857-35-0 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 318.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 207857-35-0) is a chemical compound with the molecular formula C37H36N4O8 and a molecular weight of 664.7 g/mol. IUPAC name: (2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: SLWMVWWEOHTNTR-YTTGMZPUSA-N.
| Molecular formula | C37H36N4O8 |
|---|---|
| Molecular weight | 664.7 g/mol |
| IUPAC name | (2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | SLWMVWWEOHTNTR-YTTGMZPUSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(=NCCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)NC(=O)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)