cas: 900152-72-9 — see every product listed under this CAS number, including other names
Fmoc-Asp(OtBu)-(Dmb)Gly-OH, 95%, 95% (CAS 900152-72-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H2JF-250mg |
| cas | 900152-72-9 |
| size | 250mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 50g | 2267.60 Pln | |
| Chemat | 100g | 3746.00 Pln | |
| Chemat | 250g | 8915.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(2,4-dimethoxyphenyl)methyl-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]acetic acid (CAS 900152-72-9) is a chemical compound with the molecular formula C34H38N2O9 and a molecular weight of 618.7 g/mol. IUPAC name: 2-[(2,4-dimethoxyphenyl)methyl-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]acetic acid. InChIKey: SGFXBTBQHJNOAB-NDEPHWFRSA-N.
| Molecular formula | C34H38N2O9 |
|---|---|
| Molecular weight | 618.7 g/mol |
| IUPAC name | 2-[(2,4-dimethoxyphenyl)methyl-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]acetic acid |
| InChIKey | SGFXBTBQHJNOAB-NDEPHWFRSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)N(CC1=C(C=C(C=C1)OC)OC)CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)