cas: 2241747-15-7 — see every product listed under this CAS number, including other names
Fmoc-Asp(biotinyl-PEG)-OH 95% (CAS 2241747-15-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1598376-50mg |
| cas | 2241747-15-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 726.38 Pln | |
| Ambeed | 100mg | 1193.62 Pln | |
| Ambeed | 250mg | 2194.88 Pln | |
| Ambeed | 1g | 5671.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1598376 |
(2S)-4-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 2241747-15-7) is a chemical compound with the molecular formula C39H53N5O10S and a molecular weight of 783.9 g/mol. IUPAC name: (2S)-4-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: NSWZRMACVXOYNL-RKNDVXSYSA-N.
| Molecular formula | C39H53N5O10S |
|---|---|
| Molecular weight | 783.9 g/mol |
| IUPAC name | (2S)-4-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | NSWZRMACVXOYNL-RKNDVXSYSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCCOCCOCCOCCCNC(=O)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)NC(=O)N2 |
Computed by PubChem (NCBI)