cas: 144120-53-6 — see every product listed under this CAS number, including other names
Fmoc-Asp-OAll 95% (CAS 144120-53-6) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A176715-1000g |
| cas | 144120-53-6 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 10232.69 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 331.44 Pln | |
| Ambeed | 25g | 520.56 Pln | |
| Ambeed | 100g | 1655.31 Pln | |
| Ambeed | 500g | 6416.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A176715 |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid (CAS 144120-53-6) is a chemical compound with the molecular formula C22H21NO6 and a molecular weight of 395.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid. InChIKey: ZJMVIWUCCRKNHY-IBGZPJMESA-N.
| Molecular formula | C22H21NO6 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid |
| InChIKey | ZJMVIWUCCRKNHY-IBGZPJMESA-N |
| SMILES | C=CCOC(=O)[C@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)