Products 167368-90-3
CAS 167368-90-3 appears in our catalog under these names: Fmoc-Asu(OAll)-OH, Fmoc-Asu(Oall)-OH, 99%, 99%, Fmoc-Asu(Oall)-OH, 98.65%, (S)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-8-(ALLYLOXY)-8-OXOOCTANOIC ACID, 95%, Fmoc-Asu(Oall)-OH, 99%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 0,5g, 100mg, 250mg, 1g, 1 g, 100 mg, 50 mg, 25 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-oxo-8-prop-2-enoxyoctanoic acid (CAS 167368-90-3) is a chemical compound with the molecular formula C26H29NO6 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-oxo-8-prop-2-enoxyoctanoic acid. InChIKey: GMISWTVAXZYGDF-QHCPKHFHSA-N.
| Molecular formula | C26H29NO6 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-oxo-8-prop-2-enoxyoctanoic acid |
| InChIKey | GMISWTVAXZYGDF-QHCPKHFHSA-N |
| SMILES | C=CCOC(=O)CCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)