cas: 247595-29-5 — see every product listed under this CAS number, including other names
Fmoc-Cys(Dpm)-OH 97% (CAS 247595-29-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A521423-250mg |
| cas | 247595-29-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 448.25 Pln | |
| Ambeed | 500g | 1950.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A521423 |
(2R)-3-benzhydrylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 247595-29-5) is a chemical compound with the molecular formula C31H27NO4S and a molecular weight of 509.6 g/mol. IUPAC name: (2R)-3-benzhydrylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: IVPLDYIPIHKRET-NDEPHWFRSA-N.
| Molecular formula | C31H27NO4S |
|---|---|
| Molecular weight | 509.6 g/mol |
| IUPAC name | (2R)-3-benzhydrylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | IVPLDYIPIHKRET-NDEPHWFRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)SC[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)