cas: 73724-43-3 — see every product listed under this CAS number, including other names
Fmoc-Cys(StBu)-OH, 98%, 98% (CAS 73724-43-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QN1-100mg |
| cas | 73724-43-3 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1235.60 Pln | |
| Chemat | 50g | 2334.80 Pln | |
| Chemat | 100g | 4197.20 Pln | |
| Chemat | 250g | 6698.00 Pln | |
| Chemat | 500g | 12676.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 73724-43-3) is a chemical compound with the molecular formula C22H25NO4S2 and a molecular weight of 431.6 g/mol. IUPAC name: (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZDUMTHLUTJOUML-IBGZPJMESA-N.
| Molecular formula | C22H25NO4S2 |
|---|---|
| Molecular weight | 431.6 g/mol |
| IUPAC name | (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZDUMTHLUTJOUML-IBGZPJMESA-N |
| SMILES | CC(C)(C)SSC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)