cas: 200926-18-7 — see every product listed under this CAS number, including other names
Fmoc-D-His(Fmoc)-OH 95% (CAS 200926-18-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A272279-1g |
| cas | 200926-18-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 10g | 932.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A272279 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid (CAS 200926-18-7) is a chemical compound with the molecular formula C36H29N3O6 and a molecular weight of 599.6 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid. InChIKey: WTBXFPFCUZKREB-MGBGTMOVSA-N.
| Molecular formula | C36H29N3O6 |
|---|---|
| Molecular weight | 599.6 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(9H-fluoren-9-ylmethoxycarbonyl)imidazol-4-yl]propanoic acid |
| InChIKey | WTBXFPFCUZKREB-MGBGTMOVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CN(C=N4)C(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57)C(=O)O |
Computed by PubChem (NCBI)