cas: 135610-90-1 — see every product listed under this CAS number, including other names
Fmoc-D-His(Trt)-OH, 99% (CAS 135610-90-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU0D-1g |
| cas | 135610-90-1 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 50g | 544.40 Pln | |
| Chemat | 100g | 990.80 Pln | |
| Chemat | 250g | 2200.40 Pln | |
| Chemat | 500g | 4267.20 Pln | |
| Chemat | 5kg | 32217.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 135610-90-1) is a chemical compound with the molecular formula C40H33N3O4 and a molecular weight of 619.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: XXMYDXUIZKNHDT-DIPNUNPCSA-N.
| Molecular formula | C40H33N3O4 |
|---|---|
| Molecular weight | 619.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | XXMYDXUIZKNHDT-DIPNUNPCSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@H](C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57 |
Computed by PubChem (NCBI)