cas: 1313054-60-2 — see every product listed under this CAS number, including other names
Fmoc-D-HoArg(Pbf)-OH, 95% (CAS 1313054-60-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F982272-100MG |
| cas | 1313054-60-2 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 1976.41 Pln | |
| Fluorochem | 5g | 6443.58 Pln | |
| Ambeed | 250mg | 865.44 Pln | |
| Ambeed | 1g | 1922.31 Pln | |
| Ambeed | 5g | 6422.38 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 1g | 1490.00 Pln | |
| Chemat | 5g | 5128.40 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1313054-60-2) is a chemical compound with the molecular formula C35H42N4O7S and a molecular weight of 662.8 g/mol. IUPAC name: (2R)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: DOGZBRBJANHMLA-GDLZYMKVSA-N.
| Molecular formula | C35H42N4O7S |
|---|---|
| Molecular weight | 662.8 g/mol |
| IUPAC name | (2R)-6-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DOGZBRBJANHMLA-GDLZYMKVSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCCC[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C |
Computed by PubChem (NCBI)