cas: 163619-04-3 — see every product listed under this CAS number, including other names
Fmoc-D-Trp(Boc)-OH 95% (CAS 163619-04-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142810-250mg |
| cas | 163619-04-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1193.62 Pln | |
| Ambeed | 500g | 5693.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142810 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid (CAS 163619-04-3) is a chemical compound with the molecular formula C31H30N2O6 and a molecular weight of 526.6 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid. InChIKey: ADOHASQZJSJZBT-AREMUKBSSA-N.
| Molecular formula | C31H30N2O6 |
|---|---|
| Molecular weight | 526.6 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid |
| InChIKey | ADOHASQZJSJZBT-AREMUKBSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)