cas: 1001202-16-9 — see every product listed under this CAS number, including other names
Fmoc-Gly-Gly-Gly-Gly, 97%, 97% (CAS 1001202-16-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11121F-10g |
| cas | 1001202-16-9 |
| size | 10g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 304.40 Pln | |
| Chemat | 100g | 2118.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 25g | 659.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]acetic acid (CAS 1001202-16-9) is a chemical compound with the molecular formula C23H24N4O7 and a molecular weight of 468.5 g/mol. IUPAC name: 2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]acetic acid. InChIKey: ZJOXACLWNQEOCP-UHFFFAOYSA-N.
| Molecular formula | C23H24N4O7 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | ZJOXACLWNQEOCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)O |
Computed by PubChem (NCBI)