cas: 1817857-75-2 — see every product listed under this CAS number, including other names
Fmoc-Gly-Gly-Phe-Gly-OH 95% (CAS 1817857-75-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1534320-100mg |
| cas | 1817857-75-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1310.44 Pln | |
| Ambeed | 10g | 2167.06 Pln | |
| Ambeed | 25g | 3963.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1534320 |
2-[[(2S)-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid (CAS 1817857-75-2) is a chemical compound with the molecular formula C30H30N4O7 and a molecular weight of 558.6 g/mol. IUPAC name: 2-[[(2S)-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid. InChIKey: LCOCGQVZUSLQJD-VWLOTQADSA-N.
| Molecular formula | C30H30N4O7 |
|---|---|
| Molecular weight | 558.6 g/mol |
| IUPAC name | 2-[[(2S)-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid |
| InChIKey | LCOCGQVZUSLQJD-VWLOTQADSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)O)NC(=O)CNC(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)