cas: 511272-45-0 — see every product listed under this CAS number, including other names
Fmoc-L-β-Ala-(2-furyl)-OH 95% (CAS 511272-45-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A765257-10g |
| cas | 511272-45-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 8892.12 Pln | |
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1911.19 Pln | |
| Ambeed | 5g | 5582.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A765257 |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid (CAS 511272-45-0) is a chemical compound with the molecular formula C22H19NO4S and a molecular weight of 393.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: OTFVOIGWAZDVSI-LJQANCHMSA-N.
| Molecular formula | C22H19NO4S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | OTFVOIGWAZDVSI-LJQANCHMSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CC=CS4 |
Computed by PubChem (NCBI)