cas: 1097192-05-6 — see every product listed under this CAS number, including other names
Fmoc-L-BisHomoPrapargylGly-OH 95% (CAS 1097192-05-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A635725-25g |
| cas | 1097192-05-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 18504.12 Pln | |
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 2167.06 Pln | |
| Ambeed | 5g | 5571.31 Pln | |
| Ambeed | 10g | 9287.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A635725 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hept-6-ynoic acid (CAS 1097192-05-6) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hept-6-ynoic acid. InChIKey: YWCKIQCRKHNUOY-FQEVSTJZSA-N.
| Molecular formula | C22H21NO4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hept-6-ynoic acid |
| InChIKey | YWCKIQCRKHNUOY-FQEVSTJZSA-N |
| SMILES | C#CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)