cas: 185547-51-7 — see every product listed under this CAS number, including other names
Fmoc-L-Glu-pNA, 98%, 98% (CAS 185547-51-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118TAH-250mg |
| cas | 185547-51-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 870.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(4-nitroanilino)-5-oxopentanoic acid (CAS 185547-51-7) is a chemical compound with the molecular formula C26H23N3O7 and a molecular weight of 489.5 g/mol. IUPAC name: (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(4-nitroanilino)-5-oxopentanoic acid. InChIKey: AVFZOZWSEAFFGO-QHCPKHFHSA-N.
| Molecular formula | C26H23N3O7 |
|---|---|
| Molecular weight | 489.5 g/mol |
| IUPAC name | (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-(4-nitroanilino)-5-oxopentanoic acid |
| InChIKey | AVFZOZWSEAFFGO-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)O)C(=O)NC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)