Fmoc-L-Phe(3-NHBoc)-OH, 98%
cas: 273221-84-4 — see every product listed under this CAS number, including other names
Fmoc-L-Phe(3-NHBoc)-OH, 98% (CAS 273221-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12FZ0I-100mg |
| cas | 273221-84-4 |
| size | 100mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 909.20 Pln | |
| Chemat | 5g | 4259.60 Pln | |
| Chemat | 10g | 7672.40 Pln | |
| Chemat | 25g | 15280.40 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 518.59 Pln | |
| Fluorochem | 1g | 1289.15 Pln | |
| Fluorochem | 5g | 4543.21 Pln | |
| Fluorochem | 10g | 7943.05 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoic acid (CAS 273221-84-4) is a chemical compound with the molecular formula C29H30N2O6 and a molecular weight of 502.6 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoic acid. InChIKey: IAGJEXMLJVWIJU-UHFFFAOYSA-N.
| Molecular formula | C29H30N2O6 |
|---|---|
| Molecular weight | 502.6 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoic acid |
| InChIKey | IAGJEXMLJVWIJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)