cas: 78081-87-5 — see every product listed under this CAS number, including other names
Fmoc-Lys(Fmoc)-OH 95% (CAS 78081-87-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A335064-5g |
| cas | 78081-87-5 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 375.94 Pln | |
| Ambeed | 500g | 1583.00 Pln | |
| Ambeed | 1000g | 3090.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A335064 |
(2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 78081-87-5) is a chemical compound with the molecular formula C36H34N2O6 and a molecular weight of 590.7 g/mol. IUPAC name: (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: BMJRTKDVFXYEFS-XIFFEERXSA-N.
| Molecular formula | C36H34N2O6 |
|---|---|
| Molecular weight | 590.7 g/mol |
| IUPAC name | (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | BMJRTKDVFXYEFS-XIFFEERXSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)