cas: 951695-85-5 — see every product listed under this CAS number, including other names
Fmoc-Lys(Me,Boc)-OH 95% (CAS 951695-85-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A231420-100mg |
| cas | 951695-85-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 943.31 Pln | |
| Ambeed | 25g | 4347.56 Pln | |
| Ambeed | 100g | 13764.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A231420 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid (CAS 951695-85-5) is a chemical compound with the molecular formula C27H34N2O6 and a molecular weight of 482.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid. InChIKey: JHMSFOFHTAYQLS-QHCPKHFHSA-N.
| Molecular formula | C27H34N2O6 |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid |
| InChIKey | JHMSFOFHTAYQLS-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)