cas: 167393-62-6 — see every product listed under this CAS number, including other names
Fmoc-Lys(Mtt)-OH, 98%, 98% (CAS 167393-62-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112XCK-250mg |
| cas | 167393-62-6 |
| size | 250mg |
| availability | 784.81g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1341.20 Pln | |
| Chemat | 500g | 5716.80 Pln | |
| Chemat | 50g | 722.00 Pln | |
| Chemat | 250g | 3093.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid (CAS 167393-62-6) is a chemical compound with the molecular formula C41H40N2O4 and a molecular weight of 624.8 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid. InChIKey: YPTNAIDIXCOZAJ-LHEWISCISA-N.
| Molecular formula | C41H40N2O4 |
|---|---|
| Molecular weight | 624.8 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid |
| InChIKey | YPTNAIDIXCOZAJ-LHEWISCISA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCCCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)