cas: 2375600-56-7 — see every product listed under this CAS number, including other names
Fmoc-N(Me)-Sar10 98% (CAS 2375600-56-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1964187-1g |
| cas | 2375600-56-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 23488.12 Pln | |
| Ambeed | 10mg | 776.44 Pln | |
| Ambeed | 25mg | 1405.00 Pln | |
| Ambeed | 50mg | 2339.50 Pln | |
| Ambeed | 100mg | 3919.25 Pln | |
| Ambeed | 250mg | 7384.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1964187 |
2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetic acid (CAS 2375600-56-7) is a chemical compound with the molecular formula C45H62N10O13 and a molecular weight of 951.0 g/mol. IUPAC name: 2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetic acid. InChIKey: LWJFVEBBBTXGOQ-UHFFFAOYSA-N.
| Molecular formula | C45H62N10O13 |
|---|---|
| Molecular weight | 951.0 g/mol |
| IUPAC name | 2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetic acid |
| InChIKey | LWJFVEBBBTXGOQ-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)O)C(=O)CN(C)C(=O)CN(C)C(=O)CN(C)C(=O)CN(C)C(=O)CN(C)C(=O)CN(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)