cas: 143192-31-8 — see every product listed under this CAS number, including other names
Fmoc-N-(3-Boc-aminopropyl)glycine, ≥95%(210nm), ≥95%(210nm) (CAS 143192-31-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BEN-250mg |
| cas | 143192-31-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 2171.60 Pln |
| purity | ≥95%(210nm) |
|---|---|
| delivery time | 3 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetic acid (CAS 143192-31-8) is a chemical compound with the molecular formula C25H30N2O6 and a molecular weight of 454.5 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetic acid. InChIKey: IMAPLGVUJDLQCK-UHFFFAOYSA-N.
| Molecular formula | C25H30N2O6 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetic acid |
| InChIKey | IMAPLGVUJDLQCK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)