Fmoc-N-Me-Arg(pbf)-OH, 98%
cas: 913733-27-4 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Arg(pbf)-OH, 98% (CAS 913733-27-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H26F-100mg |
| cas | 913733-27-4 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 606.80 Pln | |
| Chemat | 10g | 986.00 Pln | |
| Chemat | 25g | 2267.60 Pln | |
| Chemat | 50g | 4470.80 Pln | |
| Chemat | 250g | 10389.20 Pln | |
| Chemat | 500g | 18216.00 Pln | |
| Chemat | 1kg | 33405.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanoic acid (CAS 913733-27-4) is a chemical compound with the molecular formula C35H42N4O7S and a molecular weight of 662.8 g/mol. IUPAC name: (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanoic acid. InChIKey: MEGKXARLCPKZHJ-LJAQVGFWSA-N.
| Molecular formula | C35H42N4O7S |
|---|---|
| Molecular weight | 662.8 g/mol |
| IUPAC name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanoic acid |
| InChIKey | MEGKXARLCPKZHJ-LJAQVGFWSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)N(C)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C |
Computed by PubChem (NCBI)