Fmoc-N-Me-Trp(Boc)-OH, 97%
cas: 197632-75-0 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Trp(Boc)-OH, 97% (CAS 197632-75-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A191514-250mg |
| cas | 197632-75-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 998.94 Pln | |
| Ambeed | 25g | 4197.38 Pln | |
| BLDpharm | 100mg | 153.30 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 1075.20 Pln | |
| BLDpharm | 25g | 4518.43 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid (CAS 197632-75-0) is a chemical compound with the molecular formula C32H32N2O6 and a molecular weight of 540.6 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid. InChIKey: YMZUDCKQUKFBIR-NDEPHWFRSA-N.
| Molecular formula | C32H32N2O6 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid |
| InChIKey | YMZUDCKQUKFBIR-NDEPHWFRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)N(C)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)