cas: 867062-95-1 — see every product listed under this CAS number, including other names
Fmoc-NH-PEG3-CH2CH2COOH 97% (CAS 867062-95-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A206129-100mg |
| cas | 867062-95-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 615.13 Pln | |
| Ambeed | 10g | 898.81 Pln | |
| Ambeed | 25g | 1799.94 Pln | |
| Ambeed | 100g | 5999.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A206129 |
3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 867062-95-1) is a chemical compound with the molecular formula C24H29NO7 and a molecular weight of 443.5 g/mol. IUPAC name: 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: CHIDDYZONKDHLG-UHFFFAOYSA-N.
| Molecular formula | C24H29NO7 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | CHIDDYZONKDHLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)