cas: 882847-34-9 — see every product listed under this CAS number, including other names
Fmoc-NH-PEG6-CH2CH2COOH 95% (CAS 882847-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A356631-100mg |
| cas | 882847-34-9 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1193.62 Pln | |
| Ambeed | 25g | 5198.62 Pln | |
| Ambeed | 100g | 16479.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A356631 |
3-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 882847-34-9) is a chemical compound with the molecular formula C30H41NO10 and a molecular weight of 575.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: HEGZERUHBVYZPH-UHFFFAOYSA-N.
| Molecular formula | C30H41NO10 |
|---|---|
| Molecular weight | 575.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | HEGZERUHBVYZPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)