Fmoc-NH-PEG8-NHS ester, 95%
cas: 1334170-03-4 — see every product listed under this CAS number, including other names
Fmoc-NH-PEG8-NHS ester, 95% (CAS 1334170-03-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987024-25G |
| cas | 1334170-03-4 |
| size | 25g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 12384.20 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 825.77 Pln | |
| Fluorochem | 5g | 2528.29 Pln | |
| Fluorochem | 10g | 4985.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1334170-03-4) is a chemical compound with the molecular formula C38H52N2O14 and a molecular weight of 760.8 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: AMSAHSNOOQLQOU-UHFFFAOYSA-N.
| Molecular formula | C38H52N2O14 |
|---|---|
| Molecular weight | 760.8 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | AMSAHSNOOQLQOU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)