cas: 1807534-85-5 — see every product listed under this CAS number, including other names
Fmoc-PEG2-C2-NHS ester, 98% (CAS 1807534-85-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987014-100MG |
| cas | 1807534-85-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 409.25 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 1g | 1455.76 Pln | |
| Fluorochem | 5g | 3574.80 Pln | |
| Fluorochem | 10g | 6089.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoate (CAS 1807534-85-5) is a chemical compound with the molecular formula C26H28N2O8 and a molecular weight of 496.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoate. InChIKey: MLMVUZTWJNGUEN-UHFFFAOYSA-N.
| Molecular formula | C26H28N2O8 |
|---|---|
| Molecular weight | 496.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoate |
| InChIKey | MLMVUZTWJNGUEN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)