cas: 134303-96-1 — see every product listed under this CAS number, including other names
Fmoc-Pro-Pro-Pro-OH, 97% (CAS 134303-96-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch110DHR-100mg |
| cas | 134303-96-1 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 506.00 Pln | |
| Chemat | 10g | 803.60 Pln | |
| Chemat | 25g | 1614.80 Pln | |
| Chemat | 100g | 6232.40 Pln | |
| Fluorochem | 100g | 6339.45 Pln | |
| Fluorochem | 5g | 700.81 Pln | |
| Fluorochem | 25g | 2210.70 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-[(2S)-1-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (CAS 134303-96-1) is a chemical compound with the molecular formula C30H33N3O6 and a molecular weight of 531.6 g/mol. IUPAC name: (2S)-1-[(2S)-1-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JYDDNDUWEXGYKC-GSDHBNRESA-N.
| Molecular formula | C30H33N3O6 |
|---|---|
| Molecular weight | 531.6 g/mol |
| IUPAC name | (2S)-1-[(2S)-1-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JYDDNDUWEXGYKC-GSDHBNRESA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@@H]2CCCN2C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)N6CCC[C@H]6C(=O)O |
Computed by PubChem (NCBI)