cas: 158171-14-3 — see every product listed under this CAS number, including other names
Fmoc-Ser(HPO3Bzl)-OH, 98%, 98% (CAS 158171-14-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Q1N-250mg |
| cas | 158171-14-3 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 4336.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxypropanoic acid (CAS 158171-14-3) is a chemical compound with the molecular formula C25H24NO8P and a molecular weight of 497.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxypropanoic acid. InChIKey: ZBPUWGDUVAAWJY-QHCPKHFHSA-N.
| Molecular formula | C25H24NO8P |
|---|---|
| Molecular weight | 497.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxypropanoic acid |
| InChIKey | ZBPUWGDUVAAWJY-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C=C1)COP(=O)(O)OC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)