cas: 1000164-43-1 — see every product listed under this CAS number, including other names
Fmoc-Ser(tBu)-Ser(psi(Me,Me)pro)-OH, 98%+, 98%+ (CAS 1000164-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119T5M-100mg |
| cas | 1000164-43-1 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 50g | 2128.40 Pln | |
| Chemat | 100g | 3506.00 Pln | |
| Chemat | 250g | 5589.20 Pln | |
| Chemat | 500g | 8985.60 Pln |
| purity | 98%+ |
|---|---|
| delivery time | 3 weeks |
(4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1000164-43-1) is a chemical compound with the molecular formula C28H34N2O7 and a molecular weight of 510.6 g/mol. IUPAC name: (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: OXEDICXRSSILSN-GOTSBHOMSA-N.
| Molecular formula | C28H34N2O7 |
|---|---|
| Molecular weight | 510.6 g/mol |
| IUPAC name | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | OXEDICXRSSILSN-GOTSBHOMSA-N |
| SMILES | CC1(N([C@@H](CO1)C(=O)O)C(=O)[C@H](COC(C)(C)C)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)