Fmoc-Ser(tBu)-Thr(Psi(Me,Me)pro)-OH, 99%
cas: 1266350-99-5 — see every product listed under this CAS number, including other names
Fmoc-Ser(tBu)-Thr(Psi(Me,Me)pro)-OH, 99% (CAS 1266350-99-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C2D-250mg |
| cas | 1266350-99-5 |
| size | 250mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3165.20 Pln | |
| Chemat | 100g | 4888.40 Pln | |
| Chemat | 250g | 10389.20 Pln | |
| Chemat | 500g | 16368.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(4S,5R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1266350-99-5) is a chemical compound with the molecular formula C29H36N2O7 and a molecular weight of 524.6 g/mol. IUPAC name: (4S,5R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: AVAILEBHPYBEGO-CQLNOVPUSA-N.
| Molecular formula | C29H36N2O7 |
|---|---|
| Molecular weight | 524.6 g/mol |
| IUPAC name | (4S,5R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoyl]-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | AVAILEBHPYBEGO-CQLNOVPUSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)[C@H](COC(C)(C)C)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Ser(tBu)-Thr(Psi(Me,Me)pro)-OH, Fmoc-Ser(Tbu)-Thr(Psime,Mepro)-OH, Fmoc-Ser(tBu)-Thr[Psi(Me,Me)Pro]-OH, Fmoc-L-Ser(tBu)-L-Thr(Psi(Me,Me)pro)-OH, Fmoc-L-Ser(tBu)-L-Thr[PSI(Me,Me)Pro]-OH, orb2308663, Fmoc-Ser(tBu)-Thr(|xMe,Mepro)-OH, Fmoc-Ser(tBu)-Thr(Psi(Me ,Me)pro)-OH, Fmoc-Ser(tBu)-Thr[Psi(Me,Me)Pro]-OH>/= 99% (HPLC), (9H-Fluoren-9-yl)MethOxy]Carbonyl Ser(tBu)-ThrPsi(Me, Me)Pro-OH