CAS 883726-90-7 appears in our catalog under these names: Fmoc-Thr(PO3H2)-OH, (2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(phosphonooxy)butanoic acid, 97%, 97%, Fmoc-Thr(PO3H2)-OH, 97%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 5g, 100mg, 1g.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phosphonooxybutanoic acid (CAS 883726-90-7) is a chemical compound with the molecular formula C19H20NO8P and a molecular weight of 421.3 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phosphonooxybutanoic acid. InChIKey: OKIKUSCYAJQLRR-DIFFPNOSSA-N.
| Molecular formula | C19H20NO8P |
|---|---|
| Molecular weight | 421.3 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phosphonooxybutanoic acid |
| InChIKey | OKIKUSCYAJQLRR-DIFFPNOSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OP(=O)(O)O |
Computed by PubChem (NCBI)