CAS 273221-87-7 is the registry number for N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2,6-difluoro-L-tyrosine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-3-(2,6-difluoro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 273221-87-7) is a chemical compound with the molecular formula C24H19F2NO5 and a molecular weight of 439.4 g/mol. IUPAC name: (2S)-3-(2,6-difluoro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NUUZAOZFLRYEAB-QFIPXVFZSA-N.
| Molecular formula | C24H19F2NO5 |
|---|---|
| Molecular weight | 439.4 g/mol |
| IUPAC name | (2S)-3-(2,6-difluoro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NUUZAOZFLRYEAB-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C(C=C(C=C4F)O)F)C(=O)O |
Computed by PubChem (NCBI)