cas: 878797-09-2 — see every product listed under this CAS number, including other names
Fmoc-Tyr(tBu)-Ser[Psi(Me,Me)Pro]-OH, 95%, 95% (CAS 878797-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTMX-100mg |
| cas | 878797-09-2 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 50g | 1898.00 Pln | |
| Chemat | 100g | 3376.40 Pln | |
| Chemat | 250g | 6698.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 878797-09-2) is a chemical compound with the molecular formula C34H38N2O7 and a molecular weight of 586.7 g/mol. IUPAC name: (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: DNJYPUYQFPFOKS-VMPREFPWSA-N.
| Molecular formula | C34H38N2O7 |
|---|---|
| Molecular weight | 586.7 g/mol |
| IUPAC name | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | DNJYPUYQFPFOKS-VMPREFPWSA-N |
| SMILES | CC1(N([C@@H](CO1)C(=O)O)C(=O)[C@H](CC2=CC=C(C=C2)OC(C)(C)C)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C |
Computed by PubChem (NCBI)