Fmoc-Val-Cit-PAB-OH 98%
cas: 159858-22-7 — see every product listed under this CAS number, including other names
Fmoc-Val-Cit-PAB-OH 98% (CAS 159858-22-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192152-1mg |
| cas | 159858-22-7 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 5mg | 131.19 Pln | |
| Ambeed | 10mg | 147.88 Pln | |
| Ambeed | 25mg | 164.56 Pln | |
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Ambeed | 25g | 2634.31 Pln | |
| Ambeed | 100g | 7295.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A192152 |
9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (CAS 159858-22-7) is a chemical compound with the molecular formula C33H39N5O6 and a molecular weight of 601.7 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: DALMAZHDNFCDRP-VMPREFPWSA-N.
| Molecular formula | C33H39N5O6 |
|---|---|
| Molecular weight | 601.7 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | DALMAZHDNFCDRP-VMPREFPWSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)