cas: 863971-53-3 — see every product listed under this CAS number, including other names
Fmoc-Val-Cit-PAB-PNP, 98%, 98% (CAS 863971-53-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QO0-1mg |
| cas | 863971-53-3 |
| size | 1mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 93.20 Pln | |
| Chemat | 10mg | 107.60 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 880.40 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 3165.20 Pln | |
| Chemat | 50mg | 112.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (CAS 863971-53-3) is a chemical compound with the molecular formula C40H42N6O10 and a molecular weight of 766.8 g/mol. IUPAC name: [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate. InChIKey: USMYACISHVPTHK-PXLJZGITSA-N.
| Molecular formula | C40H42N6O10 |
|---|---|
| Molecular weight | 766.8 g/mol |
| IUPAC name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| InChIKey | USMYACISHVPTHK-PXLJZGITSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)