cas: 130878-68-1 — see every product listed under this CAS number, including other names
Fmoc-Val-OSu 95% (CAS 130878-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112178-250mg |
| cas | 130878-68-1 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 437.12 Pln | |
| Ambeed | 500g | 1744.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112178 |
(2,5-dioxopyrrolidin-1-yl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoate (CAS 130878-68-1) is a chemical compound with the molecular formula C24H24N2O6 and a molecular weight of 436.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoate. InChIKey: JPJMNCROLRPFHI-QFIPXVFZSA-N.
| Molecular formula | C24H24N2O6 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoate |
| InChIKey | JPJMNCROLRPFHI-QFIPXVFZSA-N |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)