cas: 221352-74-5 — see every product listed under this CAS number, including other names
Fmoc-cis-4-N-Boc-Pro-OH 95% (CAS 221352-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323311-100g |
| cas | 221352-74-5 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 21524.56 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 2339.50 Pln | |
| Ambeed | 25g | 6772.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A323311 |
(2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylic acid (CAS 221352-74-5) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylic acid. InChIKey: FJEXPICLVWOJSE-BTYIYWSLSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylic acid |
| InChIKey | FJEXPICLVWOJSE-BTYIYWSLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)