CAS 55920-24-6 appears in our catalog under these names: Disodium (Ethoxyoxydophosphanyl)formate, Disodium (ethyl phosphono)formate, Foscarnet impurity B. Offered by: Mikromol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 25mg, 100mg, 500mg, 1EA.
Disodium;[ethoxy(oxido)phosphoryl]formate (CAS 55920-24-6) is a chemical compound with the molecular formula C3H5Na2O5P and a molecular weight of 198.02 g/mol. IUPAC name: disodium;[ethoxy(oxido)phosphoryl]formate. InChIKey: HDPIQTPOVWZZLI-UHFFFAOYSA-L.
| Molecular formula | C3H5Na2O5P |
|---|---|
| Molecular weight | 198.02 g/mol |
| IUPAC name | disodium;[ethoxy(oxido)phosphoryl]formate |
| InChIKey | HDPIQTPOVWZZLI-UHFFFAOYSA-L |
| SMILES | CCOP(=O)(C(=O)[O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)