CAS 7704-72-5 appears in our catalog under these names: Fumaric acid potassium(1:x), Fumaric acid xpotassium salt 95%, Fumaric acid potassium(1:x), 95%, 95%, Potassium fumarate, 95%, Fumaric acid potassium(1:x), 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g, 10g.
Dipotassium;(E)-but-2-enedioate (CAS 7704-72-5) is a chemical compound with the molecular formula C4H2K2O4 and a molecular weight of 192.25 g/mol. IUPAC name: dipotassium;(E)-but-2-enedioate. InChIKey: SHPKCSFVQGSAJU-SEPHDYHBSA-L.
| Molecular formula | C4H2K2O4 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | dipotassium;(E)-but-2-enedioate |
| InChIKey | SHPKCSFVQGSAJU-SEPHDYHBSA-L |
| SMILES | C(=C/C(=O)[O-])\C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)