cas: 2933216-12-5 — see every product listed under this CAS number, including other names
G1-OC2-K3-E10 95% (CAS 2933216-12-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2750992-1mg |
| cas | 2933216-12-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 609.56 Pln | |
| Ambeed | 5mg | 1449.50 Pln | |
| Ambeed | 10mg | 2267.19 Pln | |
| Ambeed | 25mg | 4241.88 Pln | |
| Ambeed | 50mg | 7162.19 Pln | |
| Ambeed | 100mg | 12123.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2750992 |
N-[3-[bis(2-hydroxydecyl)amino]propyl]-3-[[3-[3-[bis(2-hydroxydecyl)amino]propylamino]-3-oxopropyl]-(2-hydroxyethyl)amino]propanamide (CAS 2933216-12-5) is a chemical compound with the molecular formula C54H111N5O7 and a molecular weight of 942.5 g/mol. IUPAC name: N-[3-[bis(2-hydroxydecyl)amino]propyl]-3-[[3-[3-[bis(2-hydroxydecyl)amino]propylamino]-3-oxopropyl]-(2-hydroxyethyl)amino]propanamide. InChIKey: QUXHZASDVBKOSF-UHFFFAOYSA-N.
| Molecular formula | C54H111N5O7 |
|---|---|
| Molecular weight | 942.5 g/mol |
| IUPAC name | N-[3-[bis(2-hydroxydecyl)amino]propyl]-3-[[3-[3-[bis(2-hydroxydecyl)amino]propylamino]-3-oxopropyl]-(2-hydroxyethyl)amino]propanamide |
| InChIKey | QUXHZASDVBKOSF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CN(CCCNC(=O)CCN(CCC(=O)NCCCN(CC(CCCCCCCC)O)CC(CCCCCCCC)O)CCO)CC(CCCCCCCC)O)O |
Computed by PubChem (NCBI)