CAS 300801-03-0 appears in our catalog under these names: GHK–Cu (acetate), GHK-Cu acetate, Copper tripeptide (acetate), GHK-Cu acetate, 98%, 98%, GHK-Cu acetate, min. 95 %, 5 g. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat, Roth. Available pack sizes: 100mg, 25mg, 250mg, 50mg, 0,25g, 0,5g, 1g, 5g.
Copper;acetic acid;(2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1H-imidazol-4-yl)propanoyl]amino]hexanoate (CAS 300801-03-0) is a chemical compound with the molecular formula C16H26CuN6O6 and a molecular weight of 461.96 g/mol. IUPAC name: copper;acetic acid;(2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1H-imidazol-4-yl)propanoyl]amino]hexanoate. InChIKey: NOIHSRSQDMJJFH-ULEGLUPFSA-L.
| Molecular formula | C16H26CuN6O6 |
|---|---|
| Molecular weight | 461.96 g/mol |
| IUPAC name | copper;acetic acid;(2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1H-imidazol-4-yl)propanoyl]amino]hexanoate |
| InChIKey | NOIHSRSQDMJJFH-ULEGLUPFSA-L |
| SMILES | CC(=O)O.C1=C(N=CN1)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)[O-])[N-]C(=O)CN.[Cu+2] |
Computed by PubChem (NCBI)