cas: 1033769-28-6 — see every product listed under this CAS number, including other names
GNF-5837 98+% (CAS 1033769-28-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638163-1g |
| cas | 1033769-28-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 7562.69 Pln | |
| Ambeed | 1mg | 192.38 Pln | |
| Ambeed | 5mg | 259.12 Pln | |
| Ambeed | 10mg | 409.31 Pln | |
| Ambeed | 25mg | 609.56 Pln | |
| Ambeed | 50mg | 887.69 Pln | |
| Ambeed | 100mg | 1377.19 Pln | |
| Ambeed | 250mg | 2411.81 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A638163 |
1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[4-methyl-3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea (CAS 1033769-28-6) is a chemical compound with the molecular formula C28H21F4N5O2 and a molecular weight of 535.5 g/mol. IUPAC name: 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[4-methyl-3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea. InChIKey: YYDUWLSETXNJJT-MTJSOVHGSA-N.
| Molecular formula | C28H21F4N5O2 |
|---|---|
| Molecular weight | 535.5 g/mol |
| IUPAC name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[4-methyl-3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
| InChIKey | YYDUWLSETXNJJT-MTJSOVHGSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)NC2=C(C=CC(=C2)C(F)(F)F)F)NC3=CC4=C(C=C3)/C(=C/C5=CC=CN5)/C(=O)N4 |
Computed by PubChem (NCBI)