cas: 1257326-24-1 — see every product listed under this CAS number, including other names
GSK 789472 Hydrochloride (CAS 1257326-24-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 2mg, 100mg, 200mg. Offered by: TRC, GLPBio, TargetMol.
| brand | TRC |
|---|---|
| catalog number | TRC-G797805-10MG |
| cas | 1257326-24-1 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TRC | 10mg | price on request | |
| TRC | 25mg | price on request | |
| GLPBio | 10mg | 1420.81 Pln | |
| GLPBio | 25mg | 2165.01 Pln | |
| GLPBio | 5mg | 1097.85 Pln | |
| GLPBio | 50mg | 2881.12 Pln | |
| TargetMol | 1mg | 432.54 Pln | |
| TargetMol | 2mg | 532.05 Pln | |
| TargetMol | 5mg | 751.17 Pln | |
| TargetMol | 10mg | 1036.82 Pln | |
| TargetMol | 25mg | 1887.06 Pln | |
| TargetMol | 50mg | 2670.22 Pln | |
| TargetMol | 100mg | 3932.44 Pln | |
| TargetMol | 200mg | 5134.29 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-phenyl-3-(piperidin-2-ylmethyl)imidazolidin-2-one;hydrochloride (CAS 1257326-24-1) is a chemical compound with the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. IUPAC name: 1-phenyl-3-(piperidin-2-ylmethyl)imidazolidin-2-one;hydrochloride. InChIKey: BYJUVPWUMBVSTK-UHFFFAOYSA-N.
| Molecular formula | C15H22ClN3O |
|---|---|
| Molecular weight | 295.81 g/mol |
| IUPAC name | 1-phenyl-3-(piperidin-2-ylmethyl)imidazolidin-2-one;hydrochloride |
| InChIKey | BYJUVPWUMBVSTK-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)CN2CCN(C2=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)