cas: 1142090-23-0 — see every product listed under this CAS number, including other names
GSK2256294A 99% (CAS 1142090-23-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A911625-1mg |
| cas | 1142090-23-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 459.38 Pln | |
| Ambeed | 5mg | 570.62 Pln | |
| Ambeed | 10mg | 720.81 Pln | |
| Ambeed | 25mg | 1366.06 Pln | |
| Ambeed | 50mg | 2267.19 Pln | |
| Ambeed | 100mg | 3796.88 Pln | |
| Ambeed | 250mg | 7151.06 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A911625 |
Cis-(1R,3S)-N-[[4-cyano-2-(trifluoromethyl)phenyl]methyl]-3-[[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]amino]cyclohexane-1-carboxamide (CAS 1142090-23-0) is a chemical compound with the molecular formula C21H24F3N7O and a molecular weight of 447.5 g/mol. IUPAC name: cis-(1R,3S)-N-[[4-cyano-2-(trifluoromethyl)phenyl]methyl]-3-[[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]amino]cyclohexane-1-carboxamide. InChIKey: LQHDJQIMETZMPH-ZBFHGGJFSA-N.
| Molecular formula | C21H24F3N7O |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | cis-(1R,3S)-N-[[4-cyano-2-(trifluoromethyl)phenyl]methyl]-3-[[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]amino]cyclohexane-1-carboxamide |
| InChIKey | LQHDJQIMETZMPH-ZBFHGGJFSA-N |
| SMILES | CC1=NC(=NC(=N1)N[C@H]2CCC[C@H](C2)C(=O)NCC3=C(C=C(C=C3)C#N)C(F)(F)F)NC |
Computed by PubChem (NCBI)