cas: 1142215-99-3 — see every product listed under this CAS number, including other names
Glycine, N-(4-methoxyphenyl)-N-[2-oxo-2-[(3-pyridinylmethyl)amino]ethyl]-, 95%+, 95%+ (CAS 1142215-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1101R2-100mg |
| cas | 1142215-99-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 3165.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxy-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]anilino)acetic acid (CAS 1142215-99-3) is a chemical compound with the molecular formula C17H19N3O4 and a molecular weight of 329.35 g/mol. IUPAC name: 2-(4-methoxy-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]anilino)acetic acid. InChIKey: PAXIFEVTPOMYRR-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O4 |
|---|---|
| Molecular weight | 329.35 g/mol |
| IUPAC name | 2-(4-methoxy-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]anilino)acetic acid |
| InChIKey | PAXIFEVTPOMYRR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(CC(=O)NCC2=CN=CC=C2)CC(=O)O |
Computed by PubChem (NCBI)