Guaijaverin 99%
cas: 22255-13-6 — see every product listed under this CAS number, including other names
Guaijaverin 99% (CAS 22255-13-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A891937-5mg |
| cas | 22255-13-6 |
| size | 5mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 626.25 Pln | |
| Ambeed | 10mg | 782.00 Pln | |
| Ambeed | 50mg | 998.94 Pln | |
| Ambeed | 100mg | 1638.62 Pln | |
| Ambeed | 250mg | 3201.69 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A891937 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one (CAS 22255-13-6) is a chemical compound with the molecular formula C20H18O11 and a molecular weight of 434.3 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one. InChIKey: PZZRDJXEMZMZFD-IEGSVRCHSA-N.
| Molecular formula | C20H18O11 |
|---|---|
| Molecular weight | 434.3 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
| InChIKey | PZZRDJXEMZMZFD-IEGSVRCHSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
Computed by PubChem (NCBI)