cas: 58577-88-1 — see every product listed under this CAS number, including other names
H-D-Ser(Bzl)-ol 98% (CAS 58577-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A841513-100mg |
| cas | 58577-88-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1349.38 Pln | |
| Ambeed | 25g | 6455.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A841513 |
(2S)-2-amino-3-phenylmethoxypropan-1-ol (CAS 58577-88-1) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: (2S)-2-amino-3-phenylmethoxypropan-1-ol. InChIKey: ZJUOMDNENVWMPL-JTQLQIEISA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (2S)-2-amino-3-phenylmethoxypropan-1-ol |
| InChIKey | ZJUOMDNENVWMPL-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H](CO)N |
Computed by PubChem (NCBI)