cas: 188660-14-2 — see every product listed under this CAS number, including other names
H-D-Thr(Bzl)-Obzl Oxalate (1:1), 98%, 98% (CAS 188660-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113H4R-100mg |
| cas | 188660-14-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2R,3S)-2-amino-3-phenylmethoxybutanoate;oxalic acid (CAS 188660-14-2) is a chemical compound with the molecular formula C20H23NO7 and a molecular weight of 389.4 g/mol. IUPAC name: benzyl (2R,3S)-2-amino-3-phenylmethoxybutanoate;oxalic acid. InChIKey: IIAVXHHGVJCFKI-SQQLFYIASA-N.
| Molecular formula | C20H23NO7 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | benzyl (2R,3S)-2-amino-3-phenylmethoxybutanoate;oxalic acid |
| InChIKey | IIAVXHHGVJCFKI-SQQLFYIASA-N |
| SMILES | C[C@@H]([C@H](C(=O)OCC1=CC=CC=C1)N)OCC2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)